C15H23FN2O4S — CID 100783250
(3S)-N-(3-ethoxypropyl)-3-(4-fluorophenyl)-3-(methanesulfonamido)propanamide (PubChem CID 100783250) has the molecular formula C15H23FN2O4S and a molecular weight of 346.42 g/mol. Its IUPAC name is (3S)-N-(3-ethoxypropyl)-3-(4-fluorophenyl)-3-(methanesulfonamido)propanamide.
| Compound Name | (3S)-N-(3-ethoxypropyl)-3-(4-fluorophenyl)-3-(methanesulfonamido)propanamide |
|---|---|
| PubChem CID | 100783250 |
| Molecular Formula | C15H23FN2O4S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | (3S)-N-(3-ethoxypropyl)-3-(4-fluorophenyl)-3-(methanesulfonamido)propanamide |
| SMILES | CCOCCCNC(=O)C[C@H](NS(C)(=O)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H23FN2O4S/c1-3-22-10-4-9-17-15(19)11-14(18-23(2,20)21)12-5-7-13(16)8-6-12/h5-8,14,18H,3-4,9-11H2,1-2H3,(H,17,19)/t14-/m0/s1 |
| InChIKey | DFOKIIZSRFYCCY-AWEZNQCLSA-N |
| XLogP | 1.35 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|