C14H20N2O5S — CID 22901009
2-[[1-(2-methylsulfonylethylamino)-1-oxo-3-phenylpropan-2-yl]amino]acetic acid (PubChem CID 22901009) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is 2-[[1-(2-methylsulfonylethylamino)-1-oxo-3-phenylpropan-2-yl]amino]acetic acid.
| Compound Name | 2-[[1-(2-methylsulfonylethylamino)-1-oxo-3-phenylpropan-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 22901009 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-[[1-(2-methylsulfonylethylamino)-1-oxo-3-phenylpropan-2-yl]amino]acetic acid |
| SMILES | CS(=O)(=O)CCNC(=O)C(Cc1ccccc1)NCC(=O)O |
| InChI | InChI=1S/C14H20N2O5S/c1-22(20,21)8-7-15-14(19)12(16-10-13(17)18)9-11-5-3-2-4-6-11/h2-6,12,16H,7-10H2,1H3,(H,15,19)(H,17,18) |
| InChIKey | HLAJKXVPXMCMLZ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |