C14H25N3O4S — CID 110631722
1-cyclohexyl-N-[2-(methylsulfamoyl)ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 110631722) has the molecular formula C14H25N3O4S and a molecular weight of 331.44 g/mol. Its IUPAC name is 1-cyclohexyl-N-[2-(methylsulfamoyl)ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-cyclohexyl-N-[2-(methylsulfamoyl)ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 110631722 |
| Molecular Formula | C14H25N3O4S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 1-cyclohexyl-N-[2-(methylsulfamoyl)ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CNS(=O)(=O)CCNC(=O)C1CC(=O)N(C2CCCCC2)C1 |
| InChI | InChI=1S/C14H25N3O4S/c1-15-22(20,21)8-7-16-14(19)11-9-13(18)17(10-11)12-5-3-2-4-6-12/h11-12,15H,2-10H2,1H3,(H,16,19) |
| InChIKey | YNKJWYPGANIEON-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |