C20H25N3O3 — CID 110634556
(3-methyl-5-propan-2-yl-1,2-oxazol-4-yl)-(5-morpholin-4-yl-2,3-dihydroindol-1-yl)methanone (PubChem CID 110634556) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is (3-methyl-5-propan-2-yl-1,2-oxazol-4-yl)-(5-morpholin-4-yl-2,3-dihydroindol-1-yl)methanone.
| Compound Name | (3-methyl-5-propan-2-yl-1,2-oxazol-4-yl)-(5-morpholin-4-yl-2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 110634556 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (3-methyl-5-propan-2-yl-1,2-oxazol-4-yl)-(5-morpholin-4-yl-2,3-dihydroindol-1-yl)methanone |
| SMILES | Cc1noc(C(C)C)c1C(=O)N1CCc2cc(N3CCOCC3)ccc21 |
| InChI | InChI=1S/C20H25N3O3/c1-13(2)19-18(14(3)21-26-19)20(24)23-7-6-15-12-16(4-5-17(15)23)22-8-10-25-11-9-22/h4-5,12-13H,6-11H2,1-3H3 |
| InChIKey | LPYWZRIEWIBTDN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|