C19H21BrN2O2 — CID 110637728
4-bromo-N-[4-(2,5-dimethylmorpholin-4-yl)phenyl]benzamide (PubChem CID 110637728) has the molecular formula C19H21BrN2O2 and a molecular weight of 389.29 g/mol. Its IUPAC name is 4-bromo-N-[4-(2,5-dimethylmorpholin-4-yl)phenyl]benzamide.
| Compound Name | 4-bromo-N-[4-(2,5-dimethylmorpholin-4-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 110637728 |
| Molecular Formula | C19H21BrN2O2 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 4-bromo-N-[4-(2,5-dimethylmorpholin-4-yl)phenyl]benzamide |
| SMILES | CC1CN(c2ccc(NC(=O)c3ccc(Br)cc3)cc2)C(C)CO1 |
| InChI | InChI=1S/C19H21BrN2O2/c1-13-12-24-14(2)11-22(13)18-9-7-17(8-10-18)21-19(23)15-3-5-16(20)6-4-15/h3-10,13-14H,11-12H2,1-2H3,(H,21,23) |
| InChIKey | DVTABLRGVOIJKW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |