C23H25N3O3 — CID 110640326
4-(1,3-dioxoisoindol-2-yl)-N-[(1-phenylpyrrolidin-3-yl)methyl]butanamide (PubChem CID 110640326) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[(1-phenylpyrrolidin-3-yl)methyl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(1-phenylpyrrolidin-3-yl)methyl]butanamide |
|---|---|
| PubChem CID | 110640326 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(1-phenylpyrrolidin-3-yl)methyl]butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)NCC1CCN(c2ccccc2)C1 |
| InChI | InChI=1S/C23H25N3O3/c27-21(24-15-17-12-14-25(16-17)18-7-2-1-3-8-18)11-6-13-26-22(28)19-9-4-5-10-20(19)23(26)29/h1-5,7-10,17H,6,11-16H2,(H,24,27) |
| InChIKey | RXZRERQGBHSRPJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|