C18H29NO2 — CID 110642345
N-[[1-(hydroxymethyl)cyclopentyl]methyl]adamantane-1-carboxamide (PubChem CID 110642345) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is N-[[1-(hydroxymethyl)cyclopentyl]methyl]adamantane-1-carboxamide.
| Compound Name | N-[[1-(hydroxymethyl)cyclopentyl]methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 110642345 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | N-[[1-(hydroxymethyl)cyclopentyl]methyl]adamantane-1-carboxamide |
| SMILES | O=C(NCC1(CO)CCCC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H29NO2/c20-12-17(3-1-2-4-17)11-19-16(21)18-8-13-5-14(9-18)7-15(6-13)10-18/h13-15,20H,1-12H2,(H,19,21) |
| InChIKey | UPZKIZFJKSJFAS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |