C19H20N2O4 — CID 110644585
4-(3,4-dimethoxybenzoyl)-3-phenylpiperazin-2-one (PubChem CID 110644585) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-(3,4-dimethoxybenzoyl)-3-phenylpiperazin-2-one.
| Compound Name | 4-(3,4-dimethoxybenzoyl)-3-phenylpiperazin-2-one |
|---|---|
| PubChem CID | 110644585 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 4-(3,4-dimethoxybenzoyl)-3-phenylpiperazin-2-one |
| SMILES | COc1ccc(C(=O)N2CCNC(=O)C2c2ccccc2)cc1OC |
| InChI | InChI=1S/C19H20N2O4/c1-24-15-9-8-14(12-16(15)25-2)19(23)21-11-10-20-18(22)17(21)13-6-4-3-5-7-13/h3-9,12,17H,10-11H2,1-2H3,(H,20,22) |
| InChIKey | DRWFAGQBVHEQGM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |