C16H22N2O2 — CID 110644668
4-(2,2-dimethylpropanoyl)-3-(4-methylphenyl)piperazin-2-one (PubChem CID 110644668) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoyl)-3-(4-methylphenyl)piperazin-2-one.
| Compound Name | 4-(2,2-dimethylpropanoyl)-3-(4-methylphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 110644668 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 4-(2,2-dimethylpropanoyl)-3-(4-methylphenyl)piperazin-2-one |
| SMILES | Cc1ccc(C2C(=O)NCCN2C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H22N2O2/c1-11-5-7-12(8-6-11)13-14(19)17-9-10-18(13)15(20)16(2,3)4/h5-8,13H,9-10H2,1-4H3,(H,17,19) |
| InChIKey | UXAVSFYAAUATJD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |