C14H15FN2O2 — CID 110647364
5-(4-fluorophenyl)-N-(2-methylpropyl)-1,2-oxazole-4-carboxamide (PubChem CID 110647364) has the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(2-methylpropyl)-1,2-oxazole-4-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-(2-methylpropyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 110647364 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(2-methylpropyl)-1,2-oxazole-4-carboxamide |
| SMILES | CC(C)CNC(=O)c1cnoc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C14H15FN2O2/c1-9(2)7-16-14(18)12-8-17-19-13(12)10-3-5-11(15)6-4-10/h3-6,8-9H,7H2,1-2H3,(H,16,18) |
| InChIKey | KTVBFQYGJCHFOM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |