C17H10FN3O2 — CID 110651346
N-(4-cyanophenyl)-5-(4-fluorophenyl)-1,2-oxazole-4-carboxamide (PubChem CID 110651346) has the molecular formula C17H10FN3O2 and a molecular weight of 307.28 g/mol. Its IUPAC name is N-(4-cyanophenyl)-5-(4-fluorophenyl)-1,2-oxazole-4-carboxamide.
| Compound Name | N-(4-cyanophenyl)-5-(4-fluorophenyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 110651346 |
| Molecular Formula | C17H10FN3O2 |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-(4-cyanophenyl)-5-(4-fluorophenyl)-1,2-oxazole-4-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2cnoc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H10FN3O2/c18-13-5-3-12(4-6-13)16-15(10-20-23-16)17(22)21-14-7-1-11(9-19)2-8-14/h1-8,10H,(H,21,22) |
| InChIKey | AVSPGSMIHFEOIV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |