C20H17F2N3O2 — CID 110650762
5-(3,4-difluorophenyl)-N-(4-pyrrolidin-1-ylphenyl)-1,2-oxazole-4-carboxamide (PubChem CID 110650762) has the molecular formula C20H17F2N3O2 and a molecular weight of 369.37 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-N-(4-pyrrolidin-1-ylphenyl)-1,2-oxazole-4-carboxamide.
| Compound Name | 5-(3,4-difluorophenyl)-N-(4-pyrrolidin-1-ylphenyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 110650762 |
| Molecular Formula | C20H17F2N3O2 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 5-(3,4-difluorophenyl)-N-(4-pyrrolidin-1-ylphenyl)-1,2-oxazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)cc1)c1cnoc1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H17F2N3O2/c21-17-8-3-13(11-18(17)22)19-16(12-23-27-19)20(26)24-14-4-6-15(7-5-14)25-9-1-2-10-25/h3-8,11-12H,1-2,9-10H2,(H,24,26) |
| InChIKey | TZCHYCKWMJGFCU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|