C15H14F2N2O2 — CID 110647460
[5-(3,4-difluorophenyl)-1,2-oxazol-4-yl]-piperidin-1-ylmethanone (PubChem CID 110647460) has the molecular formula C15H14F2N2O2 and a molecular weight of 292.29 g/mol. Its IUPAC name is [5-(3,4-difluorophenyl)-1,2-oxazol-4-yl]-piperidin-1-ylmethanone.
| Compound Name | [5-(3,4-difluorophenyl)-1,2-oxazol-4-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 110647460 |
| Molecular Formula | C15H14F2N2O2 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | [5-(3,4-difluorophenyl)-1,2-oxazol-4-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cnoc1-c1ccc(F)c(F)c1)N1CCCCC1 |
| InChI | InChI=1S/C15H14F2N2O2/c16-12-5-4-10(8-13(12)17)14-11(9-18-21-14)15(20)19-6-2-1-3-7-19/h4-5,8-9H,1-3,6-7H2 |
| InChIKey | HBPKDXFKRRYVQZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |