C15H16F2N2O2 — CID 110649327
N-butyl-5-(3,4-difluorophenyl)-N-methyl-1,2-oxazole-4-carboxamide (PubChem CID 110649327) has the molecular formula C15H16F2N2O2 and a molecular weight of 294.30 g/mol. Its IUPAC name is N-butyl-5-(3,4-difluorophenyl)-N-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-butyl-5-(3,4-difluorophenyl)-N-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 110649327 |
| Molecular Formula | C15H16F2N2O2 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-butyl-5-(3,4-difluorophenyl)-N-methyl-1,2-oxazole-4-carboxamide |
| SMILES | CCCCN(C)C(=O)c1cnoc1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H16F2N2O2/c1-3-4-7-19(2)15(20)11-9-18-21-14(11)10-5-6-12(16)13(17)8-10/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | NPTRHLOJMAMHSE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |