C18H16FN3O2 — CID 110650714
N-[4-(dimethylamino)phenyl]-5-(4-fluorophenyl)-1,2-oxazole-4-carboxamide (PubChem CID 110650714) has the molecular formula C18H16FN3O2 and a molecular weight of 325.34 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-5-(4-fluorophenyl)-1,2-oxazole-4-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-5-(4-fluorophenyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 110650714 |
| Molecular Formula | C18H16FN3O2 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-5-(4-fluorophenyl)-1,2-oxazole-4-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)c2cnoc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H16FN3O2/c1-22(2)15-9-7-14(8-10-15)21-18(23)16-11-20-24-17(16)12-3-5-13(19)6-4-12/h3-11H,1-2H3,(H,21,23) |
| InChIKey | OWRDADVUNNKVLY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|