C15H22O3 — CID 11064836
ethyl 4-oxo-2,3,5,6,7,8,9,10-octahydro-1H-benzo[8]annulene-3-carboxylate (PubChem CID 11064836) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is ethyl 4-oxo-2,3,5,6,7,8,9,10-octahydro-1H-benzo[8]annulene-3-carboxylate.
| Compound Name | ethyl 4-oxo-2,3,5,6,7,8,9,10-octahydro-1H-benzo[8]annulene-3-carboxylate |
|---|---|
| PubChem CID | 11064836 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | ethyl 4-oxo-2,3,5,6,7,8,9,10-octahydro-1H-benzo[8]annulene-3-carboxylate |
| SMILES | CCOC(=O)C1CCC2=C(CCCCCC2)C1=O |
| InChI | InChI=1S/C15H22O3/c1-2-18-15(17)13-10-9-11-7-5-3-4-6-8-12(11)14(13)16/h13H,2-10H2,1H3 |
| InChIKey | CGKPPAURUPLKHP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|