C14H21NO3 — CID 11064879
ethyl (2E)-2-[(1S,5S)-7-oxa-8-azatricyclo[6.4.0.01,5]dodecan-9-ylidene]acetate (PubChem CID 11064879) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is ethyl (2E)-2-[(1S,5S)-7-oxa-8-azatricyclo[6.4.0.01,5]dodecan-9-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[(1S,5S)-7-oxa-8-azatricyclo[6.4.0.01,5]dodecan-9-ylidene]acetate |
|---|---|
| PubChem CID | 11064879 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | ethyl (2E)-2-[(1S,5S)-7-oxa-8-azatricyclo[6.4.0.01,5]dodecan-9-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\CCC[C@@]23CCC[C@@H]2CON13 |
| InChI | InChI=1S/C14H21NO3/c1-2-17-13(16)9-12-6-4-8-14-7-3-5-11(14)10-18-15(12)14/h9,11H,2-8,10H2,1H3/b12-9+/t11-,14+/m1/s1 |
| InChIKey | OJPKVPOALRLIGU-PHUCXXSHSA-N |
| XLogP | 2.40 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|