C16H13Cl2N3O — CID 110653804
2,5-dichloro-N-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]aniline (PubChem CID 110653804) has the molecular formula C16H13Cl2N3O and a molecular weight of 334.21 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]aniline.
| Compound Name | 2,5-dichloro-N-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 110653804 |
| Molecular Formula | C16H13Cl2N3O |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 2,5-dichloro-N-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl]aniline |
| SMILES | Clc1ccc(Cl)c(NCCc2nnc(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C16H13Cl2N3O/c17-12-6-7-13(18)14(10-12)19-9-8-15-20-21-16(22-15)11-4-2-1-3-5-11/h1-7,10,19H,8-9H2 |
| InChIKey | VRJITEFGJXHZCU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |