C12H20N2O — CID 110653820
2-(propylamino)-1-(1,2,5-trimethylpyrrol-3-yl)ethanone (PubChem CID 110653820) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-(propylamino)-1-(1,2,5-trimethylpyrrol-3-yl)ethanone.
| Compound Name | 2-(propylamino)-1-(1,2,5-trimethylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 110653820 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2-(propylamino)-1-(1,2,5-trimethylpyrrol-3-yl)ethanone |
| SMILES | CCCNCC(=O)c1cc(C)n(C)c1C |
| InChI | InChI=1S/C12H20N2O/c1-5-6-13-8-12(15)11-7-9(2)14(4)10(11)3/h7,13H,5-6,8H2,1-4H3 |
| InChIKey | HKZNUWJHWHMEIP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|