C19H26N2O — CID 110653897
2-(2-tert-butylanilino)-1-(1,2,5-trimethylpyrrol-3-yl)ethanone (PubChem CID 110653897) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-(2-tert-butylanilino)-1-(1,2,5-trimethylpyrrol-3-yl)ethanone.
| Compound Name | 2-(2-tert-butylanilino)-1-(1,2,5-trimethylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 110653897 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 2-(2-tert-butylanilino)-1-(1,2,5-trimethylpyrrol-3-yl)ethanone |
| SMILES | Cc1cc(C(=O)CNc2ccccc2C(C)(C)C)c(C)n1C |
| InChI | InChI=1S/C19H26N2O/c1-13-11-15(14(2)21(13)6)18(22)12-20-17-10-8-7-9-16(17)19(3,4)5/h7-11,20H,12H2,1-6H3 |
| InChIKey | FRZJBSCAUJAKCT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |