C22H23ClN2O2 — CID 110653963
2-[4-[(4-chlorophenyl)methoxy]anilino]-1-(1,2,5-trimethylpyrrol-3-yl)ethanone (PubChem CID 110653963) has the molecular formula C22H23ClN2O2 and a molecular weight of 382.89 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)methoxy]anilino]-1-(1,2,5-trimethylpyrrol-3-yl)ethanone.
| Compound Name | 2-[4-[(4-chlorophenyl)methoxy]anilino]-1-(1,2,5-trimethylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 110653963 |
| Molecular Formula | C22H23ClN2O2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)methoxy]anilino]-1-(1,2,5-trimethylpyrrol-3-yl)ethanone |
| SMILES | Cc1cc(C(=O)CNc2ccc(OCc3ccc(Cl)cc3)cc2)c(C)n1C |
| InChI | InChI=1S/C22H23ClN2O2/c1-15-12-21(16(2)25(15)3)22(26)13-24-19-8-10-20(11-9-19)27-14-17-4-6-18(23)7-5-17/h4-12,24H,13-14H2,1-3H3 |
| InChIKey | QMEDZRYDSZGBNE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|