C15H13N3OS — CID 110656633
2-phenyl-5-(2-pyridin-2-ylsulfanylethyl)-1,3,4-oxadiazole (PubChem CID 110656633) has the molecular formula C15H13N3OS and a molecular weight of 283.36 g/mol. Its IUPAC name is 2-phenyl-5-(2-pyridin-2-ylsulfanylethyl)-1,3,4-oxadiazole.
| Compound Name | 2-phenyl-5-(2-pyridin-2-ylsulfanylethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 110656633 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-phenyl-5-(2-pyridin-2-ylsulfanylethyl)-1,3,4-oxadiazole |
| SMILES | c1ccc(-c2nnc(CCSc3ccccn3)o2)cc1 |
| InChI | InChI=1S/C15H13N3OS/c1-2-6-12(7-3-1)15-18-17-13(19-15)9-11-20-14-8-4-5-10-16-14/h1-8,10H,9,11H2 |
| InChIKey | XNKBNXXGJGMDCA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |