C21H22ClN3O4S — CID 110656832
3-(3-chlorophenyl)-4-(4-pyrrolidin-1-ylsulfonylbenzoyl)piperazin-2-one (PubChem CID 110656832) has the molecular formula C21H22ClN3O4S and a molecular weight of 447.94 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-4-(4-pyrrolidin-1-ylsulfonylbenzoyl)piperazin-2-one.
| Compound Name | 3-(3-chlorophenyl)-4-(4-pyrrolidin-1-ylsulfonylbenzoyl)piperazin-2-one |
|---|---|
| PubChem CID | 110656832 |
| Molecular Formula | C21H22ClN3O4S |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 3-(3-chlorophenyl)-4-(4-pyrrolidin-1-ylsulfonylbenzoyl)piperazin-2-one |
| SMILES | O=C1NCCN(C(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H22ClN3O4S/c22-17-5-3-4-16(14-17)19-20(26)23-10-13-25(19)21(27)15-6-8-18(9-7-15)30(28,29)24-11-1-2-12-24/h3-9,14,19H,1-2,10-13H2,(H,23,26) |
| InChIKey | BQRJDJWQOXPNEK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |