C17H19NO2S — CID 110660152
N-(4,5-dimethylthiophen-2-yl)-4-(4-methylphenyl)-4-oxobutanamide (PubChem CID 110660152) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is N-(4,5-dimethylthiophen-2-yl)-4-(4-methylphenyl)-4-oxobutanamide.
| Compound Name | N-(4,5-dimethylthiophen-2-yl)-4-(4-methylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 110660152 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-(4,5-dimethylthiophen-2-yl)-4-(4-methylphenyl)-4-oxobutanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)Nc2cc(C)c(C)s2)cc1 |
| InChI | InChI=1S/C17H19NO2S/c1-11-4-6-14(7-5-11)15(19)8-9-16(20)18-17-10-12(2)13(3)21-17/h4-7,10H,8-9H2,1-3H3,(H,18,20) |
| InChIKey | OXDDYXADKUMELL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |