C12H17BrN2O2 — CID 110662274
(5-bromofuran-2-yl)-(3,4,5-trimethylpiperazin-1-yl)methanone (PubChem CID 110662274) has the molecular formula C12H17BrN2O2 and a molecular weight of 301.18 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-(3,4,5-trimethylpiperazin-1-yl)methanone.
| Compound Name | (5-bromofuran-2-yl)-(3,4,5-trimethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 110662274 |
| Molecular Formula | C12H17BrN2O2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | (5-bromofuran-2-yl)-(3,4,5-trimethylpiperazin-1-yl)methanone |
| SMILES | CC1CN(C(=O)c2ccc(Br)o2)CC(C)N1C |
| InChI | InChI=1S/C12H17BrN2O2/c1-8-6-15(7-9(2)14(8)3)12(16)10-4-5-11(13)17-10/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | VPVZBHJWQQRPLR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |