C10H12BrNO4S — CID 121164470
(5-bromofuran-2-yl)-(3-ethylsulfonylazetidin-1-yl)methanone (PubChem CID 121164470) has the molecular formula C10H12BrNO4S and a molecular weight of 322.18 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-(3-ethylsulfonylazetidin-1-yl)methanone.
| Compound Name | (5-bromofuran-2-yl)-(3-ethylsulfonylazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 121164470 |
| Molecular Formula | C10H12BrNO4S |
| Molecular Weight | 322.18 g/mol |
| Exact Mass | 320.97 |
| IUPAC Name | (5-bromofuran-2-yl)-(3-ethylsulfonylazetidin-1-yl)methanone |
| SMILES | CCS(=O)(=O)C1CN(C(=O)c2ccc(Br)o2)C1 |
| InChI | InChI=1S/C10H12BrNO4S/c1-2-17(14,15)7-5-12(6-7)10(13)8-3-4-9(11)16-8/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | LFYWOTKISMIIPW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |