About [1-(4-bromophenyl)-2-thiocyanatoethyl] thiocyanate
[1-(4-bromophenyl)-2-thiocyanatoethyl] thiocyanate (PubChem CID 11066478) has the molecular formula C10H7BrN2S2
and a molecular weight of 299.22 g/mol. Its IUPAC name is [1-(4-bromophenyl)-2-thiocyanatoethyl] thiocyanate.
Molecular Properties
| Compound Name | [1-(4-bromophenyl)-2-thiocyanatoethyl] thiocyanate |
| PubChem CID | 11066478 |
| Molecular Formula | C10H7BrN2S2 |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 297.92 |
| IUPAC Name | [1-(4-bromophenyl)-2-thiocyanatoethyl] thiocyanate |
| SMILES | N#CSCC(SC#N)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H7BrN2S2/c11-9-3-1-8(2-4-9)10(15-7-13)5-14-6-12/h1-4,10H,5H2 |
| InChIKey | MWIOZCLCAAETQW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [1-(4-bromophenyl)-2-thiocyanatoethyl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-bromophenyl)-2-thiocyanatoethyl] thiocyanate?
The IUPAC name of [1-(4-bromophenyl)-2-thiocyanatoethyl] thiocyanate (CID 11066478) is [1-(4-bromophenyl)-2-thiocyanatoethyl] thiocyanate.
What is the SMILES notation for [1-(4-bromophenyl)-2-thiocyanatoethyl] thiocyanate?
The canonical SMILES for [1-(4-bromophenyl)-2-thiocyanatoethyl] thiocyanate is N#CSCC(SC#N)c1ccc(Br)cc1.
What is the InChIKey of [1-(4-bromophenyl)-2-thiocyanatoethyl] thiocyanate?
The InChIKey is MWIOZCLCAAETQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrN2S2/c11-9-3-1-8(2-4-9)10(15-7-13)5-14-6-12/h1-4,10H,5H2.
What are the key properties of [1-(4-bromophenyl)-2-thiocyanatoethyl] thiocyanate?
[1-(4-bromophenyl)-2-thiocyanatoethyl] thiocyanate has a molecular weight of 299.22 g/mol, XLogP of 3.92, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-bromophenyl)-2-thiocyanatoethyl] thiocyanate is sourced from PubChem (CID 11066478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).