About 2-propylsulfonylspiro[1,3-dihydroisoquinoline-4,1'-cyclohexane]
2-propylsulfonylspiro[1,3-dihydroisoquinoline-4,1'-cyclohexane] (PubChem CID 110667496) has the molecular formula C17H25NO2S
and a molecular weight of 307.46 g/mol. Its IUPAC name is 2-propylsulfonylspiro[1,3-dihydroisoquinoline-4,1'-cyclohexane].
Molecular Properties
| Compound Name | 2-propylsulfonylspiro[1,3-dihydroisoquinoline-4,1'-cyclohexane] |
| PubChem CID | 110667496 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 2-propylsulfonylspiro[1,3-dihydroisoquinoline-4,1'-cyclohexane] |
| SMILES | CCCS(=O)(=O)N1Cc2ccccc2C2(CCCCC2)C1 |
| InChI | InChI=1S/C17H25NO2S/c1-2-12-21(19,20)18-13-15-8-4-5-9-16(15)17(14-18)10-6-3-7-11-17/h4-5,8-9H,2-3,6-7,10-14H2,1H3 |
| InChIKey | RFHDJHYTBRGJGV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propylsulfonylspiro[1,3-dihydroisoquinoline-4,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylsulfonylspiro[1,3-dihydroisoquinoline-4,1'-cyclohexane]?
The IUPAC name of 2-propylsulfonylspiro[1,3-dihydroisoquinoline-4,1'-cyclohexane] (CID 110667496) is 2-propylsulfonylspiro[1,3-dihydroisoquinoline-4,1'-cyclohexane].
What is the SMILES notation for 2-propylsulfonylspiro[1,3-dihydroisoquinoline-4,1'-cyclohexane]?
The canonical SMILES for 2-propylsulfonylspiro[1,3-dihydroisoquinoline-4,1'-cyclohexane] is CCCS(=O)(=O)N1Cc2ccccc2C2(CCCCC2)C1.
What is the InChIKey of 2-propylsulfonylspiro[1,3-dihydroisoquinoline-4,1'-cyclohexane]?
The InChIKey is RFHDJHYTBRGJGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO2S/c1-2-12-21(19,20)18-13-15-8-4-5-9-16(15)17(14-18)10-6-3-7-11-17/h4-5,8-9H,2-3,6-7,10-14H2,1H3.
What are the key properties of 2-propylsulfonylspiro[1,3-dihydroisoquinoline-4,1'-cyclohexane]?
2-propylsulfonylspiro[1,3-dihydroisoquinoline-4,1'-cyclohexane] has a molecular weight of 307.46 g/mol, XLogP of 3.44, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylsulfonylspiro[1,3-dihydroisoquinoline-4,1'-cyclohexane] is sourced from PubChem (CID 110667496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).