C15H14FNO2S — CID 863777
2-(2-fluorophenyl)sulfonyl-3,4-dihydro-1H-isoquinoline (PubChem CID 863777) has the molecular formula C15H14FNO2S and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfonyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(2-fluorophenyl)sulfonyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 863777 |
| Molecular Formula | C15H14FNO2S |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-(2-fluorophenyl)sulfonyl-3,4-dihydro-1H-isoquinoline |
| SMILES | O=S(=O)(c1ccccc1F)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C15H14FNO2S/c16-14-7-3-4-8-15(14)20(18,19)17-10-9-12-5-1-2-6-13(12)11-17/h1-8H,9-11H2 |
| InChIKey | XDXLFDWLSVGRAV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |