C10H13FN2O2S — CID 10399576
3-(fluoromethyl)-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide (PubChem CID 10399576) has the molecular formula C10H13FN2O2S and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-(fluoromethyl)-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide.
| Compound Name | 3-(fluoromethyl)-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 10399576 |
| Molecular Formula | C10H13FN2O2S |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-(fluoromethyl)-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CNC(CF)C2 |
| InChI | InChI=1S/C10H13FN2O2S/c11-5-9-3-7-1-2-10(16(12,14)15)4-8(7)6-13-9/h1-2,4,9,13H,3,5-6H2,(H2,12,14,15) |
| InChIKey | JRESBJUYAQJNMA-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |