C16H16FN3O4S — CID 11360541
3-(fluoromethyl)-N-(4-nitrophenyl)-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide (PubChem CID 11360541) has the molecular formula C16H16FN3O4S and a molecular weight of 365.39 g/mol. Its IUPAC name is 3-(fluoromethyl)-N-(4-nitrophenyl)-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide.
| Compound Name | 3-(fluoromethyl)-N-(4-nitrophenyl)-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 11360541 |
| Molecular Formula | C16H16FN3O4S |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 3-(fluoromethyl)-N-(4-nitrophenyl)-1,2,3,4-tetrahydroisoquinoline-7-sulfonamide |
| SMILES | O=[N+]([O-])c1ccc(NS(=O)(=O)c2ccc3c(c2)CNC(CF)C3)cc1 |
| InChI | InChI=1S/C16H16FN3O4S/c17-9-14-7-11-1-6-16(8-12(11)10-18-14)25(23,24)19-13-2-4-15(5-3-13)20(21)22/h1-6,8,14,18-19H,7,9-10H2 |
| InChIKey | FWEQVNUHWLTAQJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|