C8H9N3O2S — CID 141491435
1,4-dihydrophthalazine-6-sulfonamide (PubChem CID 141491435) has the molecular formula C8H9N3O2S and a molecular weight of 211.25 g/mol. Its IUPAC name is 1,4-dihydrophthalazine-6-sulfonamide.
| Compound Name | 1,4-dihydrophthalazine-6-sulfonamide |
|---|---|
| PubChem CID | 141491435 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 1,4-dihydrophthalazine-6-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CN=NC2 |
| InChI | InChI=1S/C8H9N3O2S/c9-14(12,13)8-2-1-6-4-10-11-5-7(6)3-8/h1-3H,4-5H2,(H2,9,12,13) |
| InChIKey | KUNYJIVNRVGULF-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |