C9H12N2O2S — CID 5226
1,2,3,4-tetrahydroisoquinoline-7-sulfonamide (PubChem CID 5226) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroisoquinoline-7-sulfonamide.
| Compound Name | 1,2,3,4-tetrahydroisoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 5226 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 1,2,3,4-tetrahydroisoquinoline-7-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CNCC2 |
| InChI | InChI=1S/C9H12N2O2S/c10-14(12,13)9-2-1-7-3-4-11-6-8(7)5-9/h1-2,5,11H,3-4,6H2,(H2,10,12,13) |
| InChIKey | UGLLZXSYRBMNOS-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |