C10H10Cl3NO2S — CID 10736630
7-(trichloromethylsulfonyl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 10736630) has the molecular formula C10H10Cl3NO2S and a molecular weight of 314.62 g/mol. Its IUPAC name is 7-(trichloromethylsulfonyl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 7-(trichloromethylsulfonyl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 10736630 |
| Molecular Formula | C10H10Cl3NO2S |
| Molecular Weight | 314.62 g/mol |
| Exact Mass | 312.95 |
| IUPAC Name | 7-(trichloromethylsulfonyl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | O=S(=O)(c1ccc2c(c1)CNCC2)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H10Cl3NO2S/c11-10(12,13)17(15,16)9-2-1-7-3-4-14-6-8(7)5-9/h1-2,5,14H,3-4,6H2 |
| InChIKey | RXOZPIZFRIRRDE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.62 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|