C20H23N3O — CID 110668205
4-(dimethylamino)-N-[(1,2-dimethylindol-5-yl)methyl]benzamide (PubChem CID 110668205) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[(1,2-dimethylindol-5-yl)methyl]benzamide.
| Compound Name | 4-(dimethylamino)-N-[(1,2-dimethylindol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 110668205 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 4-(dimethylamino)-N-[(1,2-dimethylindol-5-yl)methyl]benzamide |
| SMILES | Cc1cc2cc(CNC(=O)c3ccc(N(C)C)cc3)ccc2n1C |
| InChI | InChI=1S/C20H23N3O/c1-14-11-17-12-15(5-10-19(17)23(14)4)13-21-20(24)16-6-8-18(9-7-16)22(2)3/h5-12H,13H2,1-4H3,(H,21,24) |
| InChIKey | CQQDGAKFBIEEOU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |