C14H17ClN2O — CID 7141272
(2R)-2-chloro-N-[(1,2-dimethylindol-5-yl)methyl]propanamide (PubChem CID 7141272) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is (2R)-2-chloro-N-[(1,2-dimethylindol-5-yl)methyl]propanamide.
| Compound Name | (2R)-2-chloro-N-[(1,2-dimethylindol-5-yl)methyl]propanamide |
|---|---|
| PubChem CID | 7141272 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (2R)-2-chloro-N-[(1,2-dimethylindol-5-yl)methyl]propanamide |
| SMILES | Cc1cc2cc(CNC(=O)[C@@H](C)Cl)ccc2n1C |
| InChI | InChI=1S/C14H17ClN2O/c1-9-6-12-7-11(4-5-13(12)17(9)3)8-16-14(18)10(2)15/h4-7,10H,8H2,1-3H3,(H,16,18)/t10-/m1/s1 |
| InChIKey | ASSZDXZTQXHWKY-SNVBAGLBSA-N |
| XLogP | 2.73 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|