C13H18N2 — CID 117204599
1-(1,2-dimethylindol-5-yl)propan-2-amine (PubChem CID 117204599) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-(1,2-dimethylindol-5-yl)propan-2-amine.
| Compound Name | 1-(1,2-dimethylindol-5-yl)propan-2-amine |
|---|---|
| PubChem CID | 117204599 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-(1,2-dimethylindol-5-yl)propan-2-amine |
| SMILES | Cc1cc2cc(CC(C)N)ccc2n1C |
| InChI | InChI=1S/C13H18N2/c1-9(14)6-11-4-5-13-12(8-11)7-10(2)15(13)3/h4-5,7-9H,6,14H2,1-3H3 |
| InChIKey | UHVXVXPBULKAIO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |