C14H20N2 — CID 115006318
1-(1,2,3-trimethylindol-5-yl)propan-2-amine (PubChem CID 115006318) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 1-(1,2,3-trimethylindol-5-yl)propan-2-amine.
| Compound Name | 1-(1,2,3-trimethylindol-5-yl)propan-2-amine |
|---|---|
| PubChem CID | 115006318 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-(1,2,3-trimethylindol-5-yl)propan-2-amine |
| SMILES | Cc1c(C)n(C)c2ccc(CC(C)N)cc12 |
| InChI | InChI=1S/C14H20N2/c1-9(15)7-12-5-6-14-13(8-12)10(2)11(3)16(14)4/h5-6,8-9H,7,15H2,1-4H3 |
| InChIKey | NOQWPSREMQCRTK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|