2-methyl-3-(1,2,3-trimethylindol-6-yl)propanoic acid

C15H19NO2 — CID 117365476

IUPAC2-methyl-3-(1,2,3-trimethylindol-6-yl)propanoic acid
SMILESCc1c(C)n(C)c2cc(CC(C)C(=O)O)ccc12
InChIInChI=1S/C15H19NO2/c1-9(15(17)18)7-12-5-6-13-10(2)11(3)16(4)14(13)8-12/h5-6,8-9H,7H2,1-4H3,(H,17,18)
InChIKeyWEZMGEVQQBURGF-UHFFFAOYSA-N
MW245.32 g/mol
LogP3.06
Rot. Bonds3

About 2-methyl-3-(1,2,3-trimethylindol-6-yl)propanoic acid

2-methyl-3-(1,2,3-trimethylindol-6-yl)propanoic acid (PubChem CID 117365476) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 2-methyl-3-(1,2,3-trimethylindol-6-yl)propanoic acid.

Molecular Properties

Compound Name2-methyl-3-(1,2,3-trimethylindol-6-yl)propanoic acid
PubChem CID117365476
Molecular FormulaC15H19NO2
Molecular Weight245.32 g/mol
Exact Mass245.14
IUPAC Name2-methyl-3-(1,2,3-trimethylindol-6-yl)propanoic acid
SMILESCc1c(C)n(C)c2cc(CC(C)C(=O)O)ccc12
InChIInChI=1S/C15H19NO2/c1-9(15(17)18)7-12-5-6-13-10(2)11(3)16(4)14(13)8-12/h5-6,8-9H,7H2,1-4H3,(H,17,18)
InChIKeyWEZMGEVQQBURGF-UHFFFAOYSA-N
XLogP3.06
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.32
LogP ≤ 53.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}

Analyze 2-methyl-3-(1,2,3-trimethylindol-6-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-3-(1,2,3-trimethylindol-6-yl)propanoic acid?
The IUPAC name of 2-methyl-3-(1,2,3-trimethylindol-6-yl)propanoic acid (CID 117365476) is 2-methyl-3-(1,2,3-trimethylindol-6-yl)propanoic acid.
What is the SMILES notation for 2-methyl-3-(1,2,3-trimethylindol-6-yl)propanoic acid?
The canonical SMILES for 2-methyl-3-(1,2,3-trimethylindol-6-yl)propanoic acid is Cc1c(C)n(C)c2cc(CC(C)C(=O)O)ccc12.
What is the InChIKey of 2-methyl-3-(1,2,3-trimethylindol-6-yl)propanoic acid?
The InChIKey is WEZMGEVQQBURGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO2/c1-9(15(17)18)7-12-5-6-13-10(2)11(3)16(4)14(13)8-12/h5-6,8-9H,7H2,1-4H3,(H,17,18).
What are the key properties of 2-methyl-3-(1,2,3-trimethylindol-6-yl)propanoic acid?
2-methyl-3-(1,2,3-trimethylindol-6-yl)propanoic acid has a molecular weight of 245.32 g/mol, XLogP of 3.06, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(1,2,3-trimethylindol-6-yl)propanoic acid is sourced from PubChem (CID 117365476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).