C13H14N2 — CID 83485141
6-(isocyanomethyl)-1,2,3-trimethylindole (PubChem CID 83485141) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 6-(isocyanomethyl)-1,2,3-trimethylindole.
| Compound Name | 6-(isocyanomethyl)-1,2,3-trimethylindole |
|---|---|
| PubChem CID | 83485141 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 6-(isocyanomethyl)-1,2,3-trimethylindole |
| SMILES | [C-]#[N+]Cc1ccc2c(C)c(C)n(C)c2c1 |
| InChI | InChI=1S/C13H14N2/c1-9-10(2)15(4)13-7-11(8-14-3)5-6-12(9)13/h5-7H,8H2,1-2,4H3 |
| InChIKey | AKMMQHBCXLHQNM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 9.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|