C14H20N2O2S — CID 83984997
1-(1,2-dimethyl-5-methylsulfonylindol-3-yl)propan-2-amine (PubChem CID 83984997) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-(1,2-dimethyl-5-methylsulfonylindol-3-yl)propan-2-amine.
| Compound Name | 1-(1,2-dimethyl-5-methylsulfonylindol-3-yl)propan-2-amine |
|---|---|
| PubChem CID | 83984997 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 1-(1,2-dimethyl-5-methylsulfonylindol-3-yl)propan-2-amine |
| SMILES | Cc1c(CC(C)N)c2cc(S(C)(=O)=O)ccc2n1C |
| InChI | InChI=1S/C14H20N2O2S/c1-9(15)7-12-10(2)16(3)14-6-5-11(8-13(12)14)19(4,17)18/h5-6,8-9H,7,15H2,1-4H3 |
| InChIKey | BZFNGAPJLSLIIS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|