C17H18N2 — CID 116996413
[3-(1,2-dimethylindol-5-yl)phenyl]methanamine (PubChem CID 116996413) has the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. Its IUPAC name is [3-(1,2-dimethylindol-5-yl)phenyl]methanamine.
| Compound Name | [3-(1,2-dimethylindol-5-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 116996413 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | [3-(1,2-dimethylindol-5-yl)phenyl]methanamine |
| SMILES | Cc1cc2cc(-c3cccc(CN)c3)ccc2n1C |
| InChI | InChI=1S/C17H18N2/c1-12-8-16-10-15(6-7-17(16)19(12)2)14-5-3-4-13(9-14)11-18/h3-10H,11,18H2,1-2H3 |
| InChIKey | GETKJXSMESGFQZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |