C16H16N2 — CID 116996409
3-(1,2-dimethylindol-5-yl)aniline (PubChem CID 116996409) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is 3-(1,2-dimethylindol-5-yl)aniline.
| Compound Name | 3-(1,2-dimethylindol-5-yl)aniline |
|---|---|
| PubChem CID | 116996409 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 3-(1,2-dimethylindol-5-yl)aniline |
| SMILES | Cc1cc2cc(-c3cccc(N)c3)ccc2n1C |
| InChI | InChI=1S/C16H16N2/c1-11-8-14-9-13(6-7-16(14)18(11)2)12-4-3-5-15(17)10-12/h3-10H,17H2,1-2H3 |
| InChIKey | HOPCJLZZCRFWGN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|