C16H14F3N3O — CID 110669963
pyrazin-2-yl-[2-[4-(trifluoromethyl)phenyl]pyrrolidin-1-yl]methanone (PubChem CID 110669963) has the molecular formula C16H14F3N3O and a molecular weight of 321.30 g/mol. Its IUPAC name is pyrazin-2-yl-[2-[4-(trifluoromethyl)phenyl]pyrrolidin-1-yl]methanone.
| Compound Name | pyrazin-2-yl-[2-[4-(trifluoromethyl)phenyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 110669963 |
| Molecular Formula | C16H14F3N3O |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | pyrazin-2-yl-[2-[4-(trifluoromethyl)phenyl]pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cnccn1)N1CCCC1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14F3N3O/c17-16(18,19)12-5-3-11(4-6-12)14-2-1-9-22(14)15(23)13-10-20-7-8-21-13/h3-8,10,14H,1-2,9H2 |
| InChIKey | USVGGZOUHSNOKW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |