C21H18ClN3O — CID 53379502
[2-[4-(3-chlorophenyl)phenyl]pyrrolidin-1-yl]-pyrazin-2-ylmethanone (PubChem CID 53379502) has the molecular formula C21H18ClN3O and a molecular weight of 363.85 g/mol. Its IUPAC name is [2-[4-(3-chlorophenyl)phenyl]pyrrolidin-1-yl]-pyrazin-2-ylmethanone.
| Compound Name | [2-[4-(3-chlorophenyl)phenyl]pyrrolidin-1-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 53379502 |
| Molecular Formula | C21H18ClN3O |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | [2-[4-(3-chlorophenyl)phenyl]pyrrolidin-1-yl]-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1CCCC1c1ccc(-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C21H18ClN3O/c22-18-4-1-3-17(13-18)15-6-8-16(9-7-15)20-5-2-12-25(20)21(26)19-14-23-10-11-24-19/h1,3-4,6-11,13-14,20H,2,5,12H2 |
| InChIKey | VDQFAOOAYANOKX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |