C16H23NO3 — CID 110670885
(3-ethylphenyl) 2-(3,3-dimethylbutanoylamino)acetate (PubChem CID 110670885) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is (3-ethylphenyl) 2-(3,3-dimethylbutanoylamino)acetate.
| Compound Name | (3-ethylphenyl) 2-(3,3-dimethylbutanoylamino)acetate |
|---|---|
| PubChem CID | 110670885 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (3-ethylphenyl) 2-(3,3-dimethylbutanoylamino)acetate |
| SMILES | CCc1cccc(OC(=O)CNC(=O)CC(C)(C)C)c1 |
| InChI | InChI=1S/C16H23NO3/c1-5-12-7-6-8-13(9-12)20-15(19)11-17-14(18)10-16(2,3)4/h6-9H,5,10-11H2,1-4H3,(H,17,18) |
| InChIKey | UTVRXWNYVAFKOB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|