C13H21NO4S — CID 110673080
N-(4,4-dimethoxy-4-phenylbutyl)methanesulfonamide (PubChem CID 110673080) has the molecular formula C13H21NO4S and a molecular weight of 287.38 g/mol. Its IUPAC name is N-(4,4-dimethoxy-4-phenylbutyl)methanesulfonamide.
| Compound Name | N-(4,4-dimethoxy-4-phenylbutyl)methanesulfonamide |
|---|---|
| PubChem CID | 110673080 |
| Molecular Formula | C13H21NO4S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N-(4,4-dimethoxy-4-phenylbutyl)methanesulfonamide |
| SMILES | COC(CCCNS(C)(=O)=O)(OC)c1ccccc1 |
| InChI | InChI=1S/C13H21NO4S/c1-17-13(18-2,12-8-5-4-6-9-12)10-7-11-14-19(3,15)16/h4-6,8-9,14H,7,10-11H2,1-3H3 |
| InChIKey | PXRAPLHSBFBTFA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|