C18H25NO3 — CID 110673210
(5-benzyl-3,3-dimethylmorpholin-4-yl)-(oxolan-2-yl)methanone (PubChem CID 110673210) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (5-benzyl-3,3-dimethylmorpholin-4-yl)-(oxolan-2-yl)methanone.
| Compound Name | (5-benzyl-3,3-dimethylmorpholin-4-yl)-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 110673210 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (5-benzyl-3,3-dimethylmorpholin-4-yl)-(oxolan-2-yl)methanone |
| SMILES | CC1(C)COCC(Cc2ccccc2)N1C(=O)C1CCCO1 |
| InChI | InChI=1S/C18H25NO3/c1-18(2)13-21-12-15(11-14-7-4-3-5-8-14)19(18)17(20)16-9-6-10-22-16/h3-5,7-8,15-16H,6,9-13H2,1-2H3 |
| InChIKey | LDMVCQNDDRBDMT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |