C15H23NO5S — CID 110673780
2-(3,4-dimethoxyphenyl)-N-(oxolan-2-ylmethyl)ethanesulfonamide (PubChem CID 110673780) has the molecular formula C15H23NO5S and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-(oxolan-2-ylmethyl)ethanesulfonamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-(oxolan-2-ylmethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 110673780 |
| Molecular Formula | C15H23NO5S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-(oxolan-2-ylmethyl)ethanesulfonamide |
| SMILES | COc1ccc(CCS(=O)(=O)NCC2CCCO2)cc1OC |
| InChI | InChI=1S/C15H23NO5S/c1-19-14-6-5-12(10-15(14)20-2)7-9-22(17,18)16-11-13-4-3-8-21-13/h5-6,10,13,16H,3-4,7-9,11H2,1-2H3 |
| InChIKey | CJLXLFOBVZPPJL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |