C17H21N3O4S — CID 110674272
1-[2-(2-methoxyphenyl)ethyl]-3-[(4-sulfamoylphenyl)methyl]urea (PubChem CID 110674272) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenyl)ethyl]-3-[(4-sulfamoylphenyl)methyl]urea.
| Compound Name | 1-[2-(2-methoxyphenyl)ethyl]-3-[(4-sulfamoylphenyl)methyl]urea |
|---|---|
| PubChem CID | 110674272 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 1-[2-(2-methoxyphenyl)ethyl]-3-[(4-sulfamoylphenyl)methyl]urea |
| SMILES | COc1ccccc1CCNC(=O)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H21N3O4S/c1-24-16-5-3-2-4-14(16)10-11-19-17(21)20-12-13-6-8-15(9-7-13)25(18,22)23/h2-9H,10-12H2,1H3,(H2,18,22,23)(H2,19,20,21) |
| InChIKey | FCFRMESAYSVYDD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |